About N-methyl-N-(1,2-oxazol-5-ylmethyl)cyclopropanamine
N-methyl-N-(1,2-oxazol-5-ylmethyl)cyclopropanamine (PubChem CID 131114166) has the molecular formula C8H12N2O
and a molecular weight of 152.20 g/mol. Its IUPAC name is N-methyl-N-(1,2-oxazol-5-ylmethyl)cyclopropanamine.
Analyze N-methyl-N-(1,2-oxazol-5-ylmethyl)cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-(1,2-oxazol-5-ylmethyl)cyclopropanamine?
The IUPAC name of N-methyl-N-(1,2-oxazol-5-ylmethyl)cyclopropanamine (CID 131114166) is N-methyl-N-(1,2-oxazol-5-ylmethyl)cyclopropanamine.
What is the SMILES notation for N-methyl-N-(1,2-oxazol-5-ylmethyl)cyclopropanamine?
The canonical SMILES for N-methyl-N-(1,2-oxazol-5-ylmethyl)cyclopropanamine is CN(Cc1ccno1)C1CC1.
What is the InChIKey of N-methyl-N-(1,2-oxazol-5-ylmethyl)cyclopropanamine?
The InChIKey is KINSIKWUDQLUTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O/c1-10(7-2-3-7)6-8-4-5-9-11-8/h4-5,7H,2-3,6H2,1H3.
What are the key properties of N-methyl-N-(1,2-oxazol-5-ylmethyl)cyclopropanamine?
N-methyl-N-(1,2-oxazol-5-ylmethyl)cyclopropanamine has a molecular weight of 152.20 g/mol, XLogP of 1.27, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-(1,2-oxazol-5-ylmethyl)cyclopropanamine is sourced from PubChem (CID 131114166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).