About N-benzyl-1-cyclopropyl-2,2-difluoroethanamine
N-benzyl-1-cyclopropyl-2,2-difluoroethanamine (PubChem CID 131114338) has the molecular formula C12H15F2N
and a molecular weight of 211.25 g/mol. Its IUPAC name is N-benzyl-1-cyclopropyl-2,2-difluoroethanamine.
Molecular Properties
| Compound Name | N-benzyl-1-cyclopropyl-2,2-difluoroethanamine |
| PubChem CID | 131114338 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | N-benzyl-1-cyclopropyl-2,2-difluoroethanamine |
| SMILES | FC(F)C(NCc1ccccc1)C1CC1 |
| InChI | InChI=1S/C12H15F2N/c13-12(14)11(10-6-7-10)15-8-9-4-2-1-3-5-9/h1-5,10-12,15H,6-8H2 |
| InChIKey | INKJOYNRPLUBKT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-1-cyclopropyl-2,2-difluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-1-cyclopropyl-2,2-difluoroethanamine?
The IUPAC name of N-benzyl-1-cyclopropyl-2,2-difluoroethanamine (CID 131114338) is N-benzyl-1-cyclopropyl-2,2-difluoroethanamine.
What is the SMILES notation for N-benzyl-1-cyclopropyl-2,2-difluoroethanamine?
The canonical SMILES for N-benzyl-1-cyclopropyl-2,2-difluoroethanamine is FC(F)C(NCc1ccccc1)C1CC1.
What is the InChIKey of N-benzyl-1-cyclopropyl-2,2-difluoroethanamine?
The InChIKey is INKJOYNRPLUBKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15F2N/c13-12(14)11(10-6-7-10)15-8-9-4-2-1-3-5-9/h1-5,10-12,15H,6-8H2.
What are the key properties of N-benzyl-1-cyclopropyl-2,2-difluoroethanamine?
N-benzyl-1-cyclopropyl-2,2-difluoroethanamine has a molecular weight of 211.25 g/mol, XLogP of 2.82, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-1-cyclopropyl-2,2-difluoroethanamine is sourced from PubChem (CID 131114338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).