C12H15F2N — CID 131114338
N-benzyl-1-cyclopropyl-2,2-difluoroethanamine (PubChem CID 131114338) has the molecular formula C12H15F2N and a molecular weight of 211.25 g/mol. Its IUPAC name is N-benzyl-1-cyclopropyl-2,2-difluoroethanamine.
| Compound Name | N-benzyl-1-cyclopropyl-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 131114338 |
| Molecular Formula | C12H15F2N |
| Molecular Weight | 211.25 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | N-benzyl-1-cyclopropyl-2,2-difluoroethanamine |
| SMILES | FC(F)C(NCc1ccccc1)C1CC1 |
| InChI | InChI=1S/C12H15F2N/c13-12(14)11(10-6-7-10)15-8-9-4-2-1-3-5-9/h1-5,10-12,15H,6-8H2 |
| InChIKey | INKJOYNRPLUBKT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.25 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |