C9H10Br2N2O — CID 131118655
(3S)-3-(5,6-dibromo-3-pyridinyl)morpholine (PubChem CID 131118655) has the molecular formula C9H10Br2N2O and a molecular weight of 322.00 g/mol. Its IUPAC name is (3S)-3-(5,6-dibromo-3-pyridinyl)morpholine.
| Compound Name | (3S)-3-(5,6-dibromo-3-pyridinyl)morpholine |
|---|---|
| PubChem CID | 131118655 |
| Molecular Formula | C9H10Br2N2O |
| Molecular Weight | 322.00 g/mol |
| Exact Mass | 319.92 |
| IUPAC Name | (3S)-3-(5,6-dibromo-3-pyridinyl)morpholine |
| SMILES | Brc1cc([C@H]2COCCN2)cnc1Br |
| InChI | InChI=1S/C9H10Br2N2O/c10-7-3-6(4-13-9(7)11)8-5-14-2-1-12-8/h3-4,8,12H,1-2,5H2/t8-/m1/s1 |
| InChIKey | QQANYDLYAXPZRM-MRVPVSSYSA-N |
| XLogP | 2.27 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.00 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|