C10H22N2 — CID 131122145
(3R)-1-methyl-3-propan-2-yl-1,4-diazocane (PubChem CID 131122145) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is (3R)-1-methyl-3-propan-2-yl-1,4-diazocane.
| Compound Name | (3R)-1-methyl-3-propan-2-yl-1,4-diazocane |
|---|---|
| PubChem CID | 131122145 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | (3R)-1-methyl-3-propan-2-yl-1,4-diazocane |
| SMILES | CC(C)[C@@H]1CN(C)CCCCN1 |
| InChI | InChI=1S/C10H22N2/c1-9(2)10-8-12(3)7-5-4-6-11-10/h9-11H,4-8H2,1-3H3/t10-/m0/s1 |
| InChIKey | GXVIAZVMOBPBHJ-JTQLQIEISA-N |
| XLogP | 1.33 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |