C10H16BrN3 — CID 131122744
(1R,2S)-1-(6-bromo-2-pyridinyl)-3-methylbutane-1,2-diamine (PubChem CID 131122744) has the molecular formula C10H16BrN3 and a molecular weight of 258.16 g/mol. Its IUPAC name is (1R,2S)-1-(6-bromo-2-pyridinyl)-3-methylbutane-1,2-diamine.
| Compound Name | (1R,2S)-1-(6-bromo-2-pyridinyl)-3-methylbutane-1,2-diamine |
|---|---|
| PubChem CID | 131122744 |
| Molecular Formula | C10H16BrN3 |
| Molecular Weight | 258.16 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | (1R,2S)-1-(6-bromo-2-pyridinyl)-3-methylbutane-1,2-diamine |
| SMILES | CC(C)[C@H](N)[C@@H](N)c1cccc(Br)n1 |
| InChI | InChI=1S/C10H16BrN3/c1-6(2)9(12)10(13)7-4-3-5-8(11)14-7/h3-6,9-10H,12-13H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | QYBXHIQIGAPXFZ-UWVGGRQHSA-N |
| XLogP | 1.83 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.16 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|