About 3-amino-2-(1-oxo-1,4-thiazepan-4-yl)propanoic acid
3-amino-2-(1-oxo-1,4-thiazepan-4-yl)propanoic acid (PubChem CID 131123305) has the molecular formula C8H16N2O3S
and a molecular weight of 220.29 g/mol. Its IUPAC name is 3-amino-2-(1-oxo-1,4-thiazepan-4-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-amino-2-(1-oxo-1,4-thiazepan-4-yl)propanoic acid |
| PubChem CID | 131123305 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 3-amino-2-(1-oxo-1,4-thiazepan-4-yl)propanoic acid |
| SMILES | NCC(C(=O)O)N1CCCS(=O)CC1 |
| InChI | InChI=1S/C8H16N2O3S/c9-6-7(8(11)12)10-2-1-4-14(13)5-3-10/h7H,1-6,9H2,(H,11,12) |
| InChIKey | BPPUXYUBLLYMDY-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-2-(1-oxo-1,4-thiazepan-4-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-(1-oxo-1,4-thiazepan-4-yl)propanoic acid?
The IUPAC name of 3-amino-2-(1-oxo-1,4-thiazepan-4-yl)propanoic acid (CID 131123305) is 3-amino-2-(1-oxo-1,4-thiazepan-4-yl)propanoic acid.
What is the SMILES notation for 3-amino-2-(1-oxo-1,4-thiazepan-4-yl)propanoic acid?
The canonical SMILES for 3-amino-2-(1-oxo-1,4-thiazepan-4-yl)propanoic acid is NCC(C(=O)O)N1CCCS(=O)CC1.
What is the InChIKey of 3-amino-2-(1-oxo-1,4-thiazepan-4-yl)propanoic acid?
The InChIKey is BPPUXYUBLLYMDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O3S/c9-6-7(8(11)12)10-2-1-4-14(13)5-3-10/h7H,1-6,9H2,(H,11,12).
What are the key properties of 3-amino-2-(1-oxo-1,4-thiazepan-4-yl)propanoic acid?
3-amino-2-(1-oxo-1,4-thiazepan-4-yl)propanoic acid has a molecular weight of 220.29 g/mol, XLogP of -1.15, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(1-oxo-1,4-thiazepan-4-yl)propanoic acid is sourced from PubChem (CID 131123305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).