3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid

C10H20N2O2S — CID 107454128

IUPAC3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid
SMILESCC1(C)CCN(C(CN)C(=O)O)CCS1
InChIInChI=1S/C10H20N2O2S/c1-10(2)3-4-12(5-6-15-10)8(7-11)9(13)14/h8H,3-7,11H2,1-2H3,(H,13,14)
InChIKeyQBWFFYUKJBNTSX-UHFFFAOYSA-N
MW232.35 g/mol
LogP0.62
Rot. Bonds3

About 3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid

3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid (PubChem CID 107454128) has the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid.

Molecular Properties

Compound Name3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid
PubChem CID107454128
Molecular FormulaC10H20N2O2S
Molecular Weight232.35 g/mol
Exact Mass232.12
IUPAC Name3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid
SMILESCC1(C)CCN(C(CN)C(=O)O)CCS1
InChIInChI=1S/C10H20N2O2S/c1-10(2)3-4-12(5-6-15-10)8(7-11)9(13)14/h8H,3-7,11H2,1-2H3,(H,13,14)
InChIKeyQBWFFYUKJBNTSX-UHFFFAOYSA-N
XLogP0.62
TPSA66.56 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.35
LogP ≤ 50.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid?
The IUPAC name of 3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid (CID 107454128) is 3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid.
What is the SMILES notation for 3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid?
The canonical SMILES for 3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid is CC1(C)CCN(C(CN)C(=O)O)CCS1.
What is the InChIKey of 3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid?
The InChIKey is QBWFFYUKJBNTSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2S/c1-10(2)3-4-12(5-6-15-10)8(7-11)9(13)14/h8H,3-7,11H2,1-2H3,(H,13,14).
What are the key properties of 3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid?
3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid has a molecular weight of 232.35 g/mol, XLogP of 0.62, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid is sourced from PubChem (CID 107454128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).