C10H20N2O2S — CID 107454128
3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid (PubChem CID 107454128) has the molecular formula C10H20N2O2S and a molecular weight of 232.35 g/mol. Its IUPAC name is 3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid.
| Compound Name | 3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid |
|---|---|
| PubChem CID | 107454128 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 3-amino-2-(7,7-dimethyl-1,4-thiazepan-4-yl)propanoic acid |
| SMILES | CC1(C)CCN(C(CN)C(=O)O)CCS1 |
| InChI | InChI=1S/C10H20N2O2S/c1-10(2)3-4-12(5-6-15-10)8(7-11)9(13)14/h8H,3-7,11H2,1-2H3,(H,13,14) |
| InChIKey | QBWFFYUKJBNTSX-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |