3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid

C9H18N2O2 — CID 64695632

IUPAC3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid
SMILESCC1(C)CCCN1C(CN)C(=O)O
InChIInChI=1S/C9H18N2O2/c1-9(2)4-3-5-11(9)7(6-10)8(12)13/h7H,3-6,10H2,1-2H3,(H,12,13)
InChIKeyKZZBVOKSFLUYKT-UHFFFAOYSA-N
MW186.25 g/mol
LogP0.27
Rot. Bonds3

About 3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid

3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid (PubChem CID 64695632) has the molecular formula C9H18N2O2 and a molecular weight of 186.25 g/mol. Its IUPAC name is 3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid.

Molecular Properties

Compound Name3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid
PubChem CID64695632
Molecular FormulaC9H18N2O2
Molecular Weight186.25 g/mol
Exact Mass186.14
IUPAC Name3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid
SMILESCC1(C)CCCN1C(CN)C(=O)O
InChIInChI=1S/C9H18N2O2/c1-9(2)4-3-5-11(9)7(6-10)8(12)13/h7H,3-6,10H2,1-2H3,(H,12,13)
InChIKeyKZZBVOKSFLUYKT-UHFFFAOYSA-N
XLogP0.27
TPSA66.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.25
LogP ≤ 50.27
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid?
The IUPAC name of 3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid (CID 64695632) is 3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid.
What is the SMILES notation for 3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid?
The canonical SMILES for 3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid is CC1(C)CCCN1C(CN)C(=O)O.
What is the InChIKey of 3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid?
The InChIKey is KZZBVOKSFLUYKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-9(2)4-3-5-11(9)7(6-10)8(12)13/h7H,3-6,10H2,1-2H3,(H,12,13).
What are the key properties of 3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid?
3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid has a molecular weight of 186.25 g/mol, XLogP of 0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-(2,2-dimethylpyrrolidin-1-yl)propanoic acid is sourced from PubChem (CID 64695632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).