C11H23N3O — CID 79409006
3-(2,2-dimethylpyrrolidin-1-yl)-2-methylbutanehydrazide (PubChem CID 79409006) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-(2,2-dimethylpyrrolidin-1-yl)-2-methylbutanehydrazide.
| Compound Name | 3-(2,2-dimethylpyrrolidin-1-yl)-2-methylbutanehydrazide |
|---|---|
| PubChem CID | 79409006 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 3-(2,2-dimethylpyrrolidin-1-yl)-2-methylbutanehydrazide |
| SMILES | CC(C(=O)NN)C(C)N1CCCC1(C)C |
| InChI | InChI=1S/C11H23N3O/c1-8(10(15)13-12)9(2)14-7-5-6-11(14,3)4/h8-9H,5-7,12H2,1-4H3,(H,13,15) |
| InChIKey | NBHSVBNVAWJIGM-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|