About 5-ethyl-1-(1,2,5-thiadiazol-3-ylmethyl)triazol-4-amine
5-ethyl-1-(1,2,5-thiadiazol-3-ylmethyl)triazol-4-amine (PubChem CID 131123673) has the molecular formula C7H10N6S
and a molecular weight of 210.27 g/mol. Its IUPAC name is 5-ethyl-1-(1,2,5-thiadiazol-3-ylmethyl)triazol-4-amine.
Molecular Properties
| Compound Name | 5-ethyl-1-(1,2,5-thiadiazol-3-ylmethyl)triazol-4-amine |
| PubChem CID | 131123673 |
| Molecular Formula | C7H10N6S |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | 5-ethyl-1-(1,2,5-thiadiazol-3-ylmethyl)triazol-4-amine |
| SMILES | CCc1c(N)nnn1Cc1cnsn1 |
| InChI | InChI=1S/C7H10N6S/c1-2-6-7(8)10-12-13(6)4-5-3-9-14-11-5/h3H,2,4,8H2,1H3 |
| InChIKey | PAGBGUUPFJMODP-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 5-ethyl-1-(1,2,5-thiadiazol-3-ylmethyl)triazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-1-(1,2,5-thiadiazol-3-ylmethyl)triazol-4-amine?
The IUPAC name of 5-ethyl-1-(1,2,5-thiadiazol-3-ylmethyl)triazol-4-amine (CID 131123673) is 5-ethyl-1-(1,2,5-thiadiazol-3-ylmethyl)triazol-4-amine.
What is the SMILES notation for 5-ethyl-1-(1,2,5-thiadiazol-3-ylmethyl)triazol-4-amine?
The canonical SMILES for 5-ethyl-1-(1,2,5-thiadiazol-3-ylmethyl)triazol-4-amine is CCc1c(N)nnn1Cc1cnsn1.
What is the InChIKey of 5-ethyl-1-(1,2,5-thiadiazol-3-ylmethyl)triazol-4-amine?
The InChIKey is PAGBGUUPFJMODP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N6S/c1-2-6-7(8)10-12-13(6)4-5-3-9-14-11-5/h3H,2,4,8H2,1H3.
What are the key properties of 5-ethyl-1-(1,2,5-thiadiazol-3-ylmethyl)triazol-4-amine?
5-ethyl-1-(1,2,5-thiadiazol-3-ylmethyl)triazol-4-amine has a molecular weight of 210.27 g/mol, XLogP of 0.32, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-1-(1,2,5-thiadiazol-3-ylmethyl)triazol-4-amine is sourced from PubChem (CID 131123673), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).