C8H14N2S — CID 131129978
N,4-dimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide (PubChem CID 131129978) has the molecular formula C8H14N2S and a molecular weight of 170.28 g/mol. Its IUPAC name is N,4-dimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide.
| Compound Name | N,4-dimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
|---|---|
| PubChem CID | 131129978 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | N,4-dimethyl-3,6-dihydro-2H-pyridine-1-carbothioamide |
| SMILES | CNC(=S)N1CC=C(C)CC1 |
| InChI | InChI=1S/C8H14N2S/c1-7-3-5-10(6-4-7)8(11)9-2/h3H,4-6H2,1-2H3,(H,9,11) |
| InChIKey | XYQJRMQOFWZGMB-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|