C10H19N3S — CID 163986956
5-ethyl-4-(ethylamino)-3,6-dimethyl-1,4-dihydropyrimidine-2-thione (PubChem CID 163986956) has the molecular formula C10H19N3S and a molecular weight of 213.35 g/mol. Its IUPAC name is 5-ethyl-4-(ethylamino)-3,6-dimethyl-1,4-dihydropyrimidine-2-thione.
| Compound Name | 5-ethyl-4-(ethylamino)-3,6-dimethyl-1,4-dihydropyrimidine-2-thione |
|---|---|
| PubChem CID | 163986956 |
| Molecular Formula | C10H19N3S |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | 5-ethyl-4-(ethylamino)-3,6-dimethyl-1,4-dihydropyrimidine-2-thione |
| SMILES | CCNC1C(CC)=C(C)NC(=S)N1C |
| InChI | InChI=1S/C10H19N3S/c1-5-8-7(3)12-10(14)13(4)9(8)11-6-2/h9,11H,5-6H2,1-4H3,(H,12,14) |
| InChIKey | TXEDTDNDZMNEEY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|