C9H14N4S — CID 123491948
4-amino-6-ethyl-5-methyl-1,3,7,7a-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione (PubChem CID 123491948) has the molecular formula C9H14N4S and a molecular weight of 210.31 g/mol. Its IUPAC name is 4-amino-6-ethyl-5-methyl-1,3,7,7a-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione.
| Compound Name | 4-amino-6-ethyl-5-methyl-1,3,7,7a-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 123491948 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 4-amino-6-ethyl-5-methyl-1,3,7,7a-tetrahydropyrrolo[2,3-d]pyrimidine-2-thione |
| SMILES | CCC1=C(C)C2=C(N)NC(=S)NC2N1 |
| InChI | InChI=1S/C9H14N4S/c1-3-5-4(2)6-7(10)12-9(14)13-8(6)11-5/h8,11H,3,10H2,1-2H3,(H2,12,13,14) |
| InChIKey | GIGLIYQGHWHLIK-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|