C8H12N4S — CID 91594034
4-amino-6,7-dimethyl-1,3,5,7a-tetrahydropyrrolo[3,2-d]pyrimidine-2-thione (PubChem CID 91594034) has the molecular formula C8H12N4S and a molecular weight of 196.28 g/mol. Its IUPAC name is 4-amino-6,7-dimethyl-1,3,5,7a-tetrahydropyrrolo[3,2-d]pyrimidine-2-thione.
| Compound Name | 4-amino-6,7-dimethyl-1,3,5,7a-tetrahydropyrrolo[3,2-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 91594034 |
| Molecular Formula | C8H12N4S |
| Molecular Weight | 196.28 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 4-amino-6,7-dimethyl-1,3,5,7a-tetrahydropyrrolo[3,2-d]pyrimidine-2-thione |
| SMILES | CC1=C(C)C2NC(=S)NC(N)=C2N1 |
| InChI | InChI=1S/C8H12N4S/c1-3-4(2)10-6-5(3)11-8(13)12-7(6)9/h5,10H,9H2,1-2H3,(H2,11,12,13) |
| InChIKey | LDWHBKHBFAMIIZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 62.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.28 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|