About (1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)thiourea
(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)thiourea (PubChem CID 144905345) has the molecular formula C8H15N3S
and a molecular weight of 185.30 g/mol. Its IUPAC name is (1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)thiourea.
Molecular Properties
| Compound Name | (1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)thiourea |
| PubChem CID | 144905345 |
| Molecular Formula | C8H15N3S |
| Molecular Weight | 185.30 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | (1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)thiourea |
| SMILES | CC1=C(NC(N)=S)CCN(C)C1 |
| InChI | InChI=1S/C8H15N3S/c1-6-5-11(2)4-3-7(6)10-8(9)12/h3-5H2,1-2H3,(H3,9,10,12) |
| InChIKey | JPTULAQOPXSEJO-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.30 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)thiourea?
The IUPAC name of (1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)thiourea (CID 144905345) is (1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)thiourea.
What is the SMILES notation for (1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)thiourea?
The canonical SMILES for (1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)thiourea is CC1=C(NC(N)=S)CCN(C)C1.
What is the InChIKey of (1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)thiourea?
The InChIKey is JPTULAQOPXSEJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3S/c1-6-5-11(2)4-3-7(6)10-8(9)12/h3-5H2,1-2H3,(H3,9,10,12).
What are the key properties of (1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)thiourea?
(1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)thiourea has a molecular weight of 185.30 g/mol, XLogP of 0.43, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1,5-dimethyl-3,6-dihydro-2H-pyridin-4-yl)thiourea is sourced from PubChem (CID 144905345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).