C14H27NO — CID 13113251
3-(aminomethyl)-2,2-dimethylundec-4-yn-3-ol (PubChem CID 13113251) has the molecular formula C14H27NO and a molecular weight of 225.38 g/mol. Its IUPAC name is 3-(aminomethyl)-2,2-dimethylundec-4-yn-3-ol.
| Compound Name | 3-(aminomethyl)-2,2-dimethylundec-4-yn-3-ol |
|---|---|
| PubChem CID | 13113251 |
| Molecular Formula | C14H27NO |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.21 |
| IUPAC Name | 3-(aminomethyl)-2,2-dimethylundec-4-yn-3-ol |
| SMILES | CCCCCCC#CC(O)(CN)C(C)(C)C |
| InChI | InChI=1S/C14H27NO/c1-5-6-7-8-9-10-11-14(16,12-15)13(2,3)4/h16H,5-9,12,15H2,1-4H3 |
| InChIKey | DILVCGFCAOFDGE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|