C9H15N3O — CID 131134121
N,2-dimethyl-N-(1-methylimidazol-2-yl)propanamide (PubChem CID 131134121) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is N,2-dimethyl-N-(1-methylimidazol-2-yl)propanamide.
| Compound Name | N,2-dimethyl-N-(1-methylimidazol-2-yl)propanamide |
|---|---|
| PubChem CID | 131134121 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | N,2-dimethyl-N-(1-methylimidazol-2-yl)propanamide |
| SMILES | CC(C)C(=O)N(C)c1nccn1C |
| InChI | InChI=1S/C9H15N3O/c1-7(2)8(13)12(4)9-10-5-6-11(9)3/h5-7H,1-4H3 |
| InChIKey | PGHPWYKCIQESKU-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |