C12H23Cl — CID 13113735
6-chloro-2,6,7,7-tetramethyloct-2-ene (PubChem CID 13113735) has the molecular formula C12H23Cl and a molecular weight of 202.77 g/mol. Its IUPAC name is 6-chloro-2,6,7,7-tetramethyloct-2-ene.
| Compound Name | 6-chloro-2,6,7,7-tetramethyloct-2-ene |
|---|---|
| PubChem CID | 13113735 |
| Molecular Formula | C12H23Cl |
| Molecular Weight | 202.77 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 6-chloro-2,6,7,7-tetramethyloct-2-ene |
| SMILES | CC(C)=CCCC(C)(Cl)C(C)(C)C |
| InChI | InChI=1S/C12H23Cl/c1-10(2)8-7-9-12(6,13)11(3,4)5/h8H,7,9H2,1-6H3 |
| InChIKey | QHYXXHSATOOYAW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.77 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|