C10H15F3O — CID 131142601
3-methyl-1-(2,2,2-trifluoroethyl)cyclohexane-1-carbaldehyde (PubChem CID 131142601) has the molecular formula C10H15F3O and a molecular weight of 208.22 g/mol. Its IUPAC name is 3-methyl-1-(2,2,2-trifluoroethyl)cyclohexane-1-carbaldehyde.
| Compound Name | 3-methyl-1-(2,2,2-trifluoroethyl)cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 131142601 |
| Molecular Formula | C10H15F3O |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | 3-methyl-1-(2,2,2-trifluoroethyl)cyclohexane-1-carbaldehyde |
| SMILES | CC1CCCC(C=O)(CC(F)(F)F)C1 |
| InChI | InChI=1S/C10H15F3O/c1-8-3-2-4-9(5-8,7-14)6-10(11,12)13/h7-8H,2-6H2,1H3 |
| InChIKey | HQZDVTBGFBWVQZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|