C9H15F2NOS — CID 131142911
1-(3,3-difluoropyrrolidin-1-yl)-3-methyl-2-sulfanylbutan-1-one (PubChem CID 131142911) has the molecular formula C9H15F2NOS and a molecular weight of 223.29 g/mol. Its IUPAC name is 1-(3,3-difluoropyrrolidin-1-yl)-3-methyl-2-sulfanylbutan-1-one.
| Compound Name | 1-(3,3-difluoropyrrolidin-1-yl)-3-methyl-2-sulfanylbutan-1-one |
|---|---|
| PubChem CID | 131142911 |
| Molecular Formula | C9H15F2NOS |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 1-(3,3-difluoropyrrolidin-1-yl)-3-methyl-2-sulfanylbutan-1-one |
| SMILES | CC(C)C(S)C(=O)N1CCC(F)(F)C1 |
| InChI | InChI=1S/C9H15F2NOS/c1-6(2)7(14)8(13)12-4-3-9(10,11)5-12/h6-7,14H,3-5H2,1-2H3 |
| InChIKey | FQMGFEQCJCYPPL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|