C8H3Br2ClS — CID 131145781
4,7-dibromo-2-chloro-1-benzothiophene (PubChem CID 131145781) has the molecular formula C8H3Br2ClS and a molecular weight of 326.44 g/mol. Its IUPAC name is 4,7-dibromo-2-chloro-1-benzothiophene.
| Compound Name | 4,7-dibromo-2-chloro-1-benzothiophene |
|---|---|
| PubChem CID | 131145781 |
| Molecular Formula | C8H3Br2ClS |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 323.80 |
| IUPAC Name | 4,7-dibromo-2-chloro-1-benzothiophene |
| SMILES | Clc1cc2c(Br)ccc(Br)c2s1 |
| InChI | InChI=1S/C8H3Br2ClS/c9-5-1-2-6(10)8-4(5)3-7(11)12-8/h1-3H |
| InChIKey | WASQMVUCKSXXNH-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |