C9H11FINO — CID 131150416
(1S,2R)-1-amino-1-(3-fluoro-5-iodophenyl)propan-2-ol (PubChem CID 131150416) has the molecular formula C9H11FINO and a molecular weight of 295.10 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(3-fluoro-5-iodophenyl)propan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(3-fluoro-5-iodophenyl)propan-2-ol |
|---|---|
| PubChem CID | 131150416 |
| Molecular Formula | C9H11FINO |
| Molecular Weight | 295.10 g/mol |
| Exact Mass | 294.99 |
| IUPAC Name | (1S,2R)-1-amino-1-(3-fluoro-5-iodophenyl)propan-2-ol |
| SMILES | C[C@@H](O)[C@@H](N)c1cc(F)cc(I)c1 |
| InChI | InChI=1S/C9H11FINO/c1-5(13)9(12)6-2-7(10)4-8(11)3-6/h2-5,9,13H,12H2,1H3/t5-,9-/m1/s1 |
| InChIKey | WGFHVBAEWNFKIU-MLUIRONXSA-N |
| XLogP | 1.81 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.10 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|