About 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]oxolan-3-amine
3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]oxolan-3-amine (PubChem CID 131153675) has the molecular formula C7H12N4O2
and a molecular weight of 184.20 g/mol. Its IUPAC name is 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]oxolan-3-amine.
Analyze 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]oxolan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]oxolan-3-amine?
The IUPAC name of 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]oxolan-3-amine (CID 131153675) is 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]oxolan-3-amine.
What is the SMILES notation for 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]oxolan-3-amine?
The canonical SMILES for 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]oxolan-3-amine is NCc1nc(C2(N)CCOC2)no1.
What is the InChIKey of 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]oxolan-3-amine?
The InChIKey is IXCWVPQOGVWEOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O2/c8-3-5-10-6(11-13-5)7(9)1-2-12-4-7/h1-4,8-9H2.
What are the key properties of 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]oxolan-3-amine?
3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]oxolan-3-amine has a molecular weight of 184.20 g/mol, XLogP of -0.90, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(aminomethyl)-1,2,4-oxadiazol-3-yl]oxolan-3-amine is sourced from PubChem (CID 131153675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).