C10H17N3O2 — CID 64888058
3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)oxolan-3-amine (PubChem CID 64888058) has the molecular formula C10H17N3O2 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)oxolan-3-amine.
| Compound Name | 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)oxolan-3-amine |
|---|---|
| PubChem CID | 64888058 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)oxolan-3-amine |
| SMILES | CC(C)(C)c1noc(C2(N)CCOC2)n1 |
| InChI | InChI=1S/C10H17N3O2/c1-9(2,3)7-12-8(15-13-7)10(11)4-5-14-6-10/h4-6,11H2,1-3H3 |
| InChIKey | WAVAPAKGSIBMQU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |