C10H11N3O2S — CID 64888822
3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine (PubChem CID 64888822) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine.
| Compound Name | 3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine |
|---|---|
| PubChem CID | 64888822 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)oxolan-3-amine |
| SMILES | NC1(c2nc(-c3ccsc3)no2)CCOC1 |
| InChI | InChI=1S/C10H11N3O2S/c11-10(2-3-14-6-10)9-12-8(13-15-9)7-1-4-16-5-7/h1,4-5H,2-3,6,11H2 |
| InChIKey | AXQHXLTWCPEOFG-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |