C10H10N2O2S2 — CID 86803613
3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)thiolan-3-ol (PubChem CID 86803613) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)thiolan-3-ol.
| Compound Name | 3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)thiolan-3-ol |
|---|---|
| PubChem CID | 86803613 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | 3-(3-thiophen-3-yl-1,2,4-oxadiazol-5-yl)thiolan-3-ol |
| SMILES | OC1(c2nc(-c3ccsc3)no2)CCSC1 |
| InChI | InChI=1S/C10H10N2O2S2/c13-10(2-4-16-6-10)9-11-8(12-14-9)7-1-3-15-5-7/h1,3,5,13H,2,4,6H2 |
| InChIKey | JNFUHECOMXCZCJ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |