About 3-methyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole
3-methyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole (PubChem CID 131159756) has the molecular formula C5H5N5O
and a molecular weight of 151.13 g/mol. Its IUPAC name is 3-methyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole.
Analyze 3-methyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole?
The IUPAC name of 3-methyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole (CID 131159756) is 3-methyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole.
What is the SMILES notation for 3-methyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole?
The canonical SMILES for 3-methyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole is Cc1noc(-c2ncn[nH]2)n1.
What is the InChIKey of 3-methyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole?
The InChIKey is KTZWTHARXXNWFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N5O/c1-3-8-5(11-10-3)4-6-2-7-9-4/h2H,1H3,(H,6,7,9).
What are the key properties of 3-methyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole?
3-methyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole has a molecular weight of 151.13 g/mol, XLogP of 0.16, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole is sourced from PubChem (CID 131159756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).