C11H8N6O3 — CID 62945288
5-(2-methyl-6-nitrophenyl)-3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole (PubChem CID 62945288) has the molecular formula C11H8N6O3 and a molecular weight of 272.22 g/mol. Its IUPAC name is 5-(2-methyl-6-nitrophenyl)-3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(2-methyl-6-nitrophenyl)-3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 62945288 |
| Molecular Formula | C11H8N6O3 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 5-(2-methyl-6-nitrophenyl)-3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazole |
| SMILES | Cc1cccc([N+](=O)[O-])c1-c1nc(-c2ncn[nH]2)no1 |
| InChI | InChI=1S/C11H8N6O3/c1-6-3-2-4-7(17(18)19)8(6)11-14-10(16-20-11)9-12-5-13-15-9/h2-5H,1H3,(H,12,13,15) |
| InChIKey | NFBOAJPKBLINRK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|