C16H19N7O5S — CID 97238989
N-[(1R)-2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-4-methylsulfonyl-2-nitroaniline (PubChem CID 97238989) has the molecular formula C16H19N7O5S and a molecular weight of 421.44 g/mol. Its IUPAC name is N-[(1R)-2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-4-methylsulfonyl-2-nitroaniline.
| Compound Name | N-[(1R)-2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-4-methylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 97238989 |
| Molecular Formula | C16H19N7O5S |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | N-[(1R)-2,2-dimethyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-4-methylsulfonyl-2-nitroaniline |
| SMILES | CC(C)(C)[C@@H](Nc1ccc(S(C)(=O)=O)cc1[N+](=O)[O-])c1nc(-c2ncn[nH]2)no1 |
| InChI | InChI=1S/C16H19N7O5S/c1-16(2,3)12(15-20-14(22-28-15)13-17-8-18-21-13)19-10-6-5-9(29(4,26)27)7-11(10)23(24)25/h5-8,12,19H,1-4H3,(H,17,18,21)/t12-/m0/s1 |
| InChIKey | RUZLSVFKMWGNPE-LBPRGKRZSA-N |
| XLogP | 2.37 |
| TPSA | 169.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|