C9H14FN3O — CID 131160481
[4-[[(2S)-1-fluoropropan-2-yl]amino]-6-methylpyrimidin-2-yl]methanol (PubChem CID 131160481) has the molecular formula C9H14FN3O and a molecular weight of 199.23 g/mol. Its IUPAC name is [4-[[(2S)-1-fluoropropan-2-yl]amino]-6-methylpyrimidin-2-yl]methanol.
| Compound Name | [4-[[(2S)-1-fluoropropan-2-yl]amino]-6-methylpyrimidin-2-yl]methanol |
|---|---|
| PubChem CID | 131160481 |
| Molecular Formula | C9H14FN3O |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | [4-[[(2S)-1-fluoropropan-2-yl]amino]-6-methylpyrimidin-2-yl]methanol |
| SMILES | Cc1cc(N[C@@H](C)CF)nc(CO)n1 |
| InChI | InChI=1S/C9H14FN3O/c1-6-3-8(12-7(2)4-10)13-9(5-14)11-6/h3,7,14H,4-5H2,1-2H3,(H,11,12,13)/t7-/m0/s1 |
| InChIKey | WPHIKNLROCHPED-ZETCQYMHSA-N |
| XLogP | 1.05 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |