C8H15ClN2O2S — CID 131160680
(2R)-N-(1-oxothiolan-3-yl)azetidine-2-carboxamide;hydrochloride (PubChem CID 131160680) has the molecular formula C8H15ClN2O2S and a molecular weight of 238.74 g/mol. Its IUPAC name is (2R)-N-(1-oxothiolan-3-yl)azetidine-2-carboxamide;hydrochloride.
| Compound Name | (2R)-N-(1-oxothiolan-3-yl)azetidine-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 131160680 |
| Molecular Formula | C8H15ClN2O2S |
| Molecular Weight | 238.74 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | (2R)-N-(1-oxothiolan-3-yl)azetidine-2-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NC1CCS(=O)C1)[C@H]1CCN1 |
| InChI | InChI=1S/C8H14N2O2S.ClH/c11-8(7-1-3-9-7)10-6-2-4-13(12)5-6;/h6-7,9H,1-5H2,(H,10,11);1H/t6?,7-,13?;/m1./s1 |
| InChIKey | COOZXGVYIDYCBM-SKRPOJBLSA-N |
| XLogP | -0.59 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.74 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |