C6H9F2NO2S — CID 131101676
2,2-difluoro-N-(1-oxothiolan-3-yl)acetamide (PubChem CID 131101676) has the molecular formula C6H9F2NO2S and a molecular weight of 197.21 g/mol. Its IUPAC name is 2,2-difluoro-N-(1-oxothiolan-3-yl)acetamide.
| Compound Name | 2,2-difluoro-N-(1-oxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 131101676 |
| Molecular Formula | C6H9F2NO2S |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.03 |
| IUPAC Name | 2,2-difluoro-N-(1-oxothiolan-3-yl)acetamide |
| SMILES | O=C(NC1CCS(=O)C1)C(F)F |
| InChI | InChI=1S/C6H9F2NO2S/c7-5(8)6(10)9-4-1-2-12(11)3-4/h4-5H,1-3H2,(H,9,10) |
| InChIKey | CSHQVXBSKOAROJ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |