C8H14N2O2 — CID 131162675
3-(2-hydroxypentan-3-yl)-1H-imidazol-2-one (PubChem CID 131162675) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 3-(2-hydroxypentan-3-yl)-1H-imidazol-2-one.
| Compound Name | 3-(2-hydroxypentan-3-yl)-1H-imidazol-2-one |
|---|---|
| PubChem CID | 131162675 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 3-(2-hydroxypentan-3-yl)-1H-imidazol-2-one |
| SMILES | CCC(C(C)O)n1cc[nH]c1=O |
| InChI | InChI=1S/C8H14N2O2/c1-3-7(6(2)11)10-5-4-9-8(10)12/h4-7,11H,3H2,1-2H3,(H,9,12) |
| InChIKey | ANLNZPJCDPWAEQ-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |