C9H16N2O2 — CID 137411210
1-[(2R,3S)-2-hydroxypentan-3-yl]-3-methylimidazol-2-one (PubChem CID 137411210) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 1-[(2R,3S)-2-hydroxypentan-3-yl]-3-methylimidazol-2-one.
| Compound Name | 1-[(2R,3S)-2-hydroxypentan-3-yl]-3-methylimidazol-2-one |
|---|---|
| PubChem CID | 137411210 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 1-[(2R,3S)-2-hydroxypentan-3-yl]-3-methylimidazol-2-one |
| SMILES | CC[C@@H]([C@@H](C)O)n1ccn(C)c1=O |
| InChI | InChI=1S/C9H16N2O2/c1-4-8(7(2)12)11-6-5-10(3)9(11)13/h5-8,12H,4H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | GZWUYMJKCJLFAJ-SFYZADRCSA-N |
| XLogP | 0.52 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |