C9H5Cl3S — CID 131169653
3,7-dichloro-5-(chloromethyl)-1-benzothiophene (PubChem CID 131169653) has the molecular formula C9H5Cl3S and a molecular weight of 251.56 g/mol. Its IUPAC name is 3,7-dichloro-5-(chloromethyl)-1-benzothiophene.
| Compound Name | 3,7-dichloro-5-(chloromethyl)-1-benzothiophene |
|---|---|
| PubChem CID | 131169653 |
| Molecular Formula | C9H5Cl3S |
| Molecular Weight | 251.56 g/mol |
| Exact Mass | 249.92 |
| IUPAC Name | 3,7-dichloro-5-(chloromethyl)-1-benzothiophene |
| SMILES | ClCc1cc(Cl)c2scc(Cl)c2c1 |
| InChI | InChI=1S/C9H5Cl3S/c10-3-5-1-6-8(12)4-13-9(6)7(11)2-5/h1-2,4H,3H2 |
| InChIKey | AWBMJGYGQCJVOP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.56 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|