C8H3Cl2FS — CID 130884776
3,5-dichloro-7-fluoro-1-benzothiophene (PubChem CID 130884776) has the molecular formula C8H3Cl2FS and a molecular weight of 221.08 g/mol. Its IUPAC name is 3,5-dichloro-7-fluoro-1-benzothiophene.
| Compound Name | 3,5-dichloro-7-fluoro-1-benzothiophene |
|---|---|
| PubChem CID | 130884776 |
| Molecular Formula | C8H3Cl2FS |
| Molecular Weight | 221.08 g/mol |
| Exact Mass | 219.93 |
| IUPAC Name | 3,5-dichloro-7-fluoro-1-benzothiophene |
| SMILES | Fc1cc(Cl)cc2c(Cl)csc12 |
| InChI | InChI=1S/C8H3Cl2FS/c9-4-1-5-6(10)3-12-8(5)7(11)2-4/h1-3H |
| InChIKey | IKMKZBLRNNPECT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.08 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |