C7H12N2S — CID 131172265
N-ethyl-1-(1,2-thiazol-3-yl)ethanamine (PubChem CID 131172265) has the molecular formula C7H12N2S and a molecular weight of 156.25 g/mol. Its IUPAC name is N-ethyl-1-(1,2-thiazol-3-yl)ethanamine.
| Compound Name | N-ethyl-1-(1,2-thiazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 131172265 |
| Molecular Formula | C7H12N2S |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.07 |
| IUPAC Name | N-ethyl-1-(1,2-thiazol-3-yl)ethanamine |
| SMILES | CCNC(C)c1ccsn1 |
| InChI | InChI=1S/C7H12N2S/c1-3-8-6(2)7-4-5-10-9-7/h4-6,8H,3H2,1-2H3 |
| InChIKey | UFBYCGBSUOLMTH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |