C9H13NO3 — CID 131173030
1-(2-methylprop-2-enoxy)piperidine-2,4-dione (PubChem CID 131173030) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is 1-(2-methylprop-2-enoxy)piperidine-2,4-dione.
| Compound Name | 1-(2-methylprop-2-enoxy)piperidine-2,4-dione |
|---|---|
| PubChem CID | 131173030 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | 1-(2-methylprop-2-enoxy)piperidine-2,4-dione |
| SMILES | C=C(C)CON1CCC(=O)CC1=O |
| InChI | InChI=1S/C9H13NO3/c1-7(2)6-13-10-4-3-8(11)5-9(10)12/h1,3-6H2,2H3 |
| InChIKey | MFQQOWAPSFGSPE-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|