C8H11NO2 — CID 143515185
1-prop-1-en-2-ylpiperidine-2,4-dione (PubChem CID 143515185) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 1-prop-1-en-2-ylpiperidine-2,4-dione.
| Compound Name | 1-prop-1-en-2-ylpiperidine-2,4-dione |
|---|---|
| PubChem CID | 143515185 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 1-prop-1-en-2-ylpiperidine-2,4-dione |
| SMILES | C=C(C)N1CCC(=O)CC1=O |
| InChI | InChI=1S/C8H11NO2/c1-6(2)9-4-3-7(10)5-8(9)11/h1,3-5H2,2H3 |
| InChIKey | JEAOZMCBAHZKBT-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|