C20H29BrN2O8 — CID 160906280
tert-butyl 3-bromo-2,4-dioxopiperidine-1-carboxylate;tert-butyl 2,4-dioxopiperidine-1-carboxylate (PubChem CID 160906280) has the molecular formula C20H29BrN2O8 and a molecular weight of 505.36 g/mol. Its IUPAC name is tert-butyl 3-bromo-2,4-dioxopiperidine-1-carboxylate;tert-butyl 2,4-dioxopiperidine-1-carboxylate.
| Compound Name | tert-butyl 3-bromo-2,4-dioxopiperidine-1-carboxylate;tert-butyl 2,4-dioxopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 160906280 |
| Molecular Formula | C20H29BrN2O8 |
| Molecular Weight | 505.36 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | tert-butyl 3-bromo-2,4-dioxopiperidine-1-carboxylate;tert-butyl 2,4-dioxopiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(Br)C1=O.CC(C)(C)OC(=O)N1CCC(=O)CC1=O |
| InChI | InChI=1S/C10H14BrNO4.C10H15NO4/c1-10(2,3)16-9(15)12-5-4-6(13)7(11)8(12)14;1-10(2,3)15-9(14)11-5-4-7(12)6-8(11)13/h7H,4-5H2,1-3H3;4-6H2,1-3H3 |
| InChIKey | SQEIUOXZNABINK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|