C10H19FN2O — CID 131181807
1-fluoro-3-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propan-2-ol (PubChem CID 131181807) has the molecular formula C10H19FN2O and a molecular weight of 202.27 g/mol. Its IUPAC name is 1-fluoro-3-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propan-2-ol.
| Compound Name | 1-fluoro-3-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 131181807 |
| Molecular Formula | C10H19FN2O |
| Molecular Weight | 202.27 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-fluoro-3-(4-methyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)propan-2-ol |
| SMILES | CC1C2CNCC2CN1CC(O)CF |
| InChI | InChI=1S/C10H19FN2O/c1-7-10-4-12-3-8(10)5-13(7)6-9(14)2-11/h7-10,12,14H,2-6H2,1H3 |
| InChIKey | LWHTYOXDBZZGQG-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.27 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |