C11H19F3N2O — CID 66209898
3-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1,1,1-trifluoropropan-2-ol (PubChem CID 66209898) has the molecular formula C11H19F3N2O and a molecular weight of 252.28 g/mol. Its IUPAC name is 3-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 66209898 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 3-(4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCC1C2CNCC2CN1CC(O)C(F)(F)F |
| InChI | InChI=1S/C11H19F3N2O/c1-2-9-8-4-15-3-7(8)5-16(9)6-10(17)11(12,13)14/h7-10,15,17H,2-6H2,1H3 |
| InChIKey | DFQHMQZQWIXZOM-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |