C11H19BrN2 — CID 66209140
5-(2-bromoprop-2-enyl)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole (PubChem CID 66209140) has the molecular formula C11H19BrN2 and a molecular weight of 259.19 g/mol. Its IUPAC name is 5-(2-bromoprop-2-enyl)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole.
| Compound Name | 5-(2-bromoprop-2-enyl)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 66209140 |
| Molecular Formula | C11H19BrN2 |
| Molecular Weight | 259.19 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 5-(2-bromoprop-2-enyl)-4-ethyl-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrole |
| SMILES | C=C(Br)CN1CC2CNCC2C1CC |
| InChI | InChI=1S/C11H19BrN2/c1-3-11-10-5-13-4-9(10)7-14(11)6-8(2)12/h9-11,13H,2-7H2,1H3 |
| InChIKey | MIDFWDIPCXBUQT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |