C11H21N3O2 — CID 131182277
tert-butyl N-[2-(cyanomethylamino)-2-methylpropyl]carbamate (PubChem CID 131182277) has the molecular formula C11H21N3O2 and a molecular weight of 227.31 g/mol. Its IUPAC name is tert-butyl N-[2-(cyanomethylamino)-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[2-(cyanomethylamino)-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 131182277 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.16 |
| IUPAC Name | tert-butyl N-[2-(cyanomethylamino)-2-methylpropyl]carbamate |
| SMILES | CC(C)(CNC(=O)OC(C)(C)C)NCC#N |
| InChI | InChI=1S/C11H21N3O2/c1-10(2,3)16-9(15)13-8-11(4,5)14-7-6-12/h14H,7-8H2,1-5H3,(H,13,15) |
| InChIKey | BHGZBTPQDVWWBW-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|