C14H25N3O2S — CID 142274791
tert-butyl N-[6-[(2-cyanoethanethioyl)amino]hexyl]carbamate (PubChem CID 142274791) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is tert-butyl N-[6-[(2-cyanoethanethioyl)amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[(2-cyanoethanethioyl)amino]hexyl]carbamate |
|---|---|
| PubChem CID | 142274791 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | tert-butyl N-[6-[(2-cyanoethanethioyl)amino]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCNC(=S)CC#N |
| InChI | InChI=1S/C14H25N3O2S/c1-14(2,3)19-13(18)17-11-7-5-4-6-10-16-12(20)8-9-15/h4-8,10-11H2,1-3H3,(H,16,20)(H,17,18) |
| InChIKey | FKSBBBZRZFSVQB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|