C10H16N2OS — CID 131183022
(3-methyl-1,2-thiazol-5-yl)-(oxan-3-yl)methanamine (PubChem CID 131183022) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is (3-methyl-1,2-thiazol-5-yl)-(oxan-3-yl)methanamine.
| Compound Name | (3-methyl-1,2-thiazol-5-yl)-(oxan-3-yl)methanamine |
|---|---|
| PubChem CID | 131183022 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | (3-methyl-1,2-thiazol-5-yl)-(oxan-3-yl)methanamine |
| SMILES | Cc1cc(C(N)C2CCCOC2)sn1 |
| InChI | InChI=1S/C10H16N2OS/c1-7-5-9(14-12-7)10(11)8-3-2-4-13-6-8/h5,8,10H,2-4,6,11H2,1H3 |
| InChIKey | IONGDPLXHWTVTR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |