C9H10ClN3 — CID 131183370
(1R)-1-(5-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)ethanamine (PubChem CID 131183370) has the molecular formula C9H10ClN3 and a molecular weight of 195.65 g/mol. Its IUPAC name is (1R)-1-(5-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)ethanamine.
| Compound Name | (1R)-1-(5-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)ethanamine |
|---|---|
| PubChem CID | 131183370 |
| Molecular Formula | C9H10ClN3 |
| Molecular Weight | 195.65 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | (1R)-1-(5-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)ethanamine |
| SMILES | C[C@@H](N)c1c(Cl)cnc2[nH]ccc12 |
| InChI | InChI=1S/C9H10ClN3/c1-5(11)8-6-2-3-12-9(6)13-4-7(8)10/h2-5H,11H2,1H3,(H,12,13)/t5-/m1/s1 |
| InChIKey | OVRLHPGESMFEPD-RXMQYKEDSA-N |
| XLogP | 2.24 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.65 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |