C18H21NO2 — CID 13118869
(3R,5R)-4-butyl-3,5-diphenyl-1,2,4-dioxazolidine (PubChem CID 13118869) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is (3R,5R)-4-butyl-3,5-diphenyl-1,2,4-dioxazolidine.
| Compound Name | (3R,5R)-4-butyl-3,5-diphenyl-1,2,4-dioxazolidine |
|---|---|
| PubChem CID | 13118869 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | (3R,5R)-4-butyl-3,5-diphenyl-1,2,4-dioxazolidine |
| SMILES | CCCCN1[C@@H](c2ccccc2)OO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H21NO2/c1-2-3-14-19-17(15-10-6-4-7-11-15)20-21-18(19)16-12-8-5-9-13-16/h4-13,17-18H,2-3,14H2,1H3/t17-,18-/m1/s1 |
| InChIKey | CLAYGIUSQFPTAQ-QZTJIDSGSA-N |
| XLogP | 4.45 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|