C12H16BNO2 — CID 86573275
1-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)piperidine (PubChem CID 86573275) has the molecular formula C12H16BNO2 and a molecular weight of 217.08 g/mol. Its IUPAC name is 1-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)piperidine.
| Compound Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)piperidine |
|---|---|
| PubChem CID | 86573275 |
| Molecular Formula | C12H16BNO2 |
| Molecular Weight | 217.08 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-3-yl)piperidine |
| SMILES | OB1OC(N2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C12H16BNO2/c15-13-11-7-3-2-6-10(11)12(16-13)14-8-4-1-5-9-14/h2-3,6-7,12,15H,1,4-5,8-9H2 |
| InChIKey | UEZXPODZXRZYID-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.08 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|