C18H20B2N2O4 — CID 86573308
1,4-bis(1-hydroxy-3H-2,1-benzoxaborol-3-yl)piperazine (PubChem CID 86573308) has the molecular formula C18H20B2N2O4 and a molecular weight of 349.99 g/mol. Its IUPAC name is 1,4-bis(1-hydroxy-3H-2,1-benzoxaborol-3-yl)piperazine.
| Compound Name | 1,4-bis(1-hydroxy-3H-2,1-benzoxaborol-3-yl)piperazine |
|---|---|
| PubChem CID | 86573308 |
| Molecular Formula | C18H20B2N2O4 |
| Molecular Weight | 349.99 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1,4-bis(1-hydroxy-3H-2,1-benzoxaborol-3-yl)piperazine |
| SMILES | OB1OC(N2CCN(C3OB(O)c4ccccc43)CC2)c2ccccc21 |
| InChI | InChI=1S/C18H20B2N2O4/c23-19-15-7-3-1-5-13(15)17(25-19)21-9-11-22(12-10-21)18-14-6-2-4-8-16(14)20(24)26-18/h1-8,17-18,23-24H,9-12H2 |
| InChIKey | DXZQBHJXVXKYJB-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 65.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.99 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|